C15H20N2O2S — CID 79952207
6-[(4,4-dimethylthian-3-yl)amino]-4H-1,4-benzoxazin-3-one (PubChem CID 79952207) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 6-[(4,4-dimethylthian-3-yl)amino]-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-[(4,4-dimethylthian-3-yl)amino]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 79952207 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 6-[(4,4-dimethylthian-3-yl)amino]-4H-1,4-benzoxazin-3-one |
| SMILES | CC1(C)CCSCC1Nc1ccc2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C15H20N2O2S/c1-15(2)5-6-20-9-13(15)16-10-3-4-12-11(7-10)17-14(18)8-19-12/h3-4,7,13,16H,5-6,8-9H2,1-2H3,(H,17,18) |
| InChIKey | OPTMBSBPUWOSLF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|