2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid

C10H16F3NO2S — CID 79952375

IUPAC2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid
SMILESCC1SCCCC1N(CC(=O)O)CC(F)(F)F
InChIInChI=1S/C10H16F3NO2S/c1-7-8(3-2-4-17-7)14(5-9(15)16)6-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16)
InChIKeyPGSOCDAWIUKCDO-UHFFFAOYSA-N
MW271.30 g/mol
LogP2.22
Rot. Bonds4

About 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid

2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 79952375) has the molecular formula C10H16F3NO2S and a molecular weight of 271.30 g/mol. Its IUPAC name is 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid
PubChem CID79952375
Molecular FormulaC10H16F3NO2S
Molecular Weight271.30 g/mol
Exact Mass271.09
IUPAC Name2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid
SMILESCC1SCCCC1N(CC(=O)O)CC(F)(F)F
InChIInChI=1S/C10H16F3NO2S/c1-7-8(3-2-4-17-7)14(5-9(15)16)6-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16)
InChIKeyPGSOCDAWIUKCDO-UHFFFAOYSA-N
XLogP2.22
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.30
LogP ≤ 52.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid?
The IUPAC name of 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid (CID 79952375) is 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid is CC1SCCCC1N(CC(=O)O)CC(F)(F)F.
What is the InChIKey of 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid?
The InChIKey is PGSOCDAWIUKCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO2S/c1-7-8(3-2-4-17-7)14(5-9(15)16)6-10(11,12)13/h7-8H,2-6H2,1H3,(H,15,16).
What are the key properties of 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid?
2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid has a molecular weight of 271.30 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylthian-3-yl)-(2,2,2-trifluoroethyl)amino]acetic acid is sourced from PubChem (CID 79952375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).