C9H11ClF3NS — CID 79952579
1-(5-chlorothiophen-2-yl)-5,5,5-trifluoropentan-2-amine (PubChem CID 79952579) has the molecular formula C9H11ClF3NS and a molecular weight of 257.71 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-5,5,5-trifluoropentan-2-amine.
| Compound Name | 1-(5-chlorothiophen-2-yl)-5,5,5-trifluoropentan-2-amine |
|---|---|
| PubChem CID | 79952579 |
| Molecular Formula | C9H11ClF3NS |
| Molecular Weight | 257.71 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-5,5,5-trifluoropentan-2-amine |
| SMILES | NC(CCC(F)(F)F)Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C9H11ClF3NS/c10-8-2-1-7(15-8)5-6(14)3-4-9(11,12)13/h1-2,6H,3-5,14H2 |
| InChIKey | SAOXSAYKICQGRT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.71 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |