About N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine (PubChem CID 79952619) has the molecular formula C14H18FN5S
and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine |
| PubChem CID | 79952619 |
| Molecular Formula | C14H18FN5S |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1Nc1cc(-n2cnnn2)ccc1F |
| InChI | InChI=1S/C14H18FN5S/c1-14(2)5-6-21-8-13(14)17-12-7-10(3-4-11(12)15)20-9-16-18-19-20/h3-4,7,9,13,17H,5-6,8H2,1-2H3 |
| InChIKey | SKTWEGZWBBFLLC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine?
The IUPAC name of N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine (CID 79952619) is N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine.
What is the SMILES notation for N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine?
The canonical SMILES for N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine is CC1(C)CCSCC1Nc1cc(-n2cnnn2)ccc1F.
What is the InChIKey of N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine?
The InChIKey is SKTWEGZWBBFLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FN5S/c1-14(2)5-6-21-8-13(14)17-12-7-10(3-4-11(12)15)20-9-16-18-19-20/h3-4,7,9,13,17H,5-6,8H2,1-2H3.
What are the key properties of N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine?
N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine has a molecular weight of 307.40 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-fluoro-5-(tetrazol-1-yl)phenyl]-4,4-dimethylthian-3-amine is sourced from PubChem (CID 79952619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).