About N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine
N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine (PubChem CID 79952624) has the molecular formula C14H17Cl2F2NOS
and a molecular weight of 356.27 g/mol. Its IUPAC name is N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine |
| PubChem CID | 79952624 |
| Molecular Formula | C14H17Cl2F2NOS |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1Nc1cc(Cl)c(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2F2NOS/c1-14(2)3-4-21-7-11(14)19-8-5-9(15)12(10(16)6-8)20-13(17)18/h5-6,11,13,19H,3-4,7H2,1-2H3 |
| InChIKey | KIJCKTNKPCIEDC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine?
The IUPAC name of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine (CID 79952624) is N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine.
What is the SMILES notation for N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine?
The canonical SMILES for N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine is CC1(C)CCSCC1Nc1cc(Cl)c(OC(F)F)c(Cl)c1.
What is the InChIKey of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine?
The InChIKey is KIJCKTNKPCIEDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2F2NOS/c1-14(2)3-4-21-7-11(14)19-8-5-9(15)12(10(16)6-8)20-13(17)18/h5-6,11,13,19H,3-4,7H2,1-2H3.
What are the key properties of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine?
N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine has a molecular weight of 356.27 g/mol, XLogP of 5.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dichloro-4-(difluoromethoxy)phenyl]-4,4-dimethylthian-3-amine is sourced from PubChem (CID 79952624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).