About 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine
1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 79952895) has the molecular formula C12H22F3N
and a molecular weight of 237.31 g/mol. Its IUPAC name is 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 79952895 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | CCC1CCCCC1C(N)CCC(F)(F)F |
| InChI | InChI=1S/C12H22F3N/c1-2-9-5-3-4-6-10(9)11(16)7-8-12(13,14)15/h9-11H,2-8,16H2,1H3 |
| InChIKey | VZNRKXPXVSMSJP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
The IUPAC name of 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine (CID 79952895) is 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine is CCC1CCCCC1C(N)CCC(F)(F)F.
What is the InChIKey of 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
The InChIKey is VZNRKXPXVSMSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N/c1-2-9-5-3-4-6-10(9)11(16)7-8-12(13,14)15/h9-11H,2-8,16H2,1H3.
What are the key properties of 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine has a molecular weight of 237.31 g/mol, XLogP of 3.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 79952895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).