C10H11Cl2F3N2 — CID 79952984
4,6-dichloro-5-propyl-2-(3,3,3-trifluoropropyl)pyrimidine (PubChem CID 79952984) has the molecular formula C10H11Cl2F3N2 and a molecular weight of 287.11 g/mol. Its IUPAC name is 4,6-dichloro-5-propyl-2-(3,3,3-trifluoropropyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-propyl-2-(3,3,3-trifluoropropyl)pyrimidine |
|---|---|
| PubChem CID | 79952984 |
| Molecular Formula | C10H11Cl2F3N2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 4,6-dichloro-5-propyl-2-(3,3,3-trifluoropropyl)pyrimidine |
| SMILES | CCCc1c(Cl)nc(CCC(F)(F)F)nc1Cl |
| InChI | InChI=1S/C10H11Cl2F3N2/c1-2-3-6-8(11)16-7(17-9(6)12)4-5-10(13,14)15/h2-5H2,1H3 |
| InChIKey | HTLDRAKJHAGMFM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |