About 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol
7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol (PubChem CID 79953577) has the molecular formula C9H17F3O3S
and a molecular weight of 262.29 g/mol. Its IUPAC name is 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol.
Molecular Properties
| Compound Name | 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol |
| PubChem CID | 79953577 |
| Molecular Formula | C9H17F3O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol |
| SMILES | CCS(=O)(=O)CCCC(O)CCC(F)(F)F |
| InChI | InChI=1S/C9H17F3O3S/c1-2-16(14,15)7-3-4-8(13)5-6-9(10,11)12/h8,13H,2-7H2,1H3 |
| InChIKey | NFARTSCRLQEVTE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol?
The IUPAC name of 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol (CID 79953577) is 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol.
What is the SMILES notation for 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol?
The canonical SMILES for 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol is CCS(=O)(=O)CCCC(O)CCC(F)(F)F.
What is the InChIKey of 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol?
The InChIKey is NFARTSCRLQEVTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3O3S/c1-2-16(14,15)7-3-4-8(13)5-6-9(10,11)12/h8,13H,2-7H2,1H3.
What are the key properties of 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol?
7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol has a molecular weight of 262.29 g/mol, XLogP of 1.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethylsulfonyl-1,1,1-trifluoroheptan-4-ol is sourced from PubChem (CID 79953577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).