C18H28N2S — CID 79953618
1-benzyl-N-(5,5-dimethylthian-3-yl)pyrrolidin-3-amine (PubChem CID 79953618) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-benzyl-N-(5,5-dimethylthian-3-yl)pyrrolidin-3-amine.
| Compound Name | 1-benzyl-N-(5,5-dimethylthian-3-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 79953618 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-benzyl-N-(5,5-dimethylthian-3-yl)pyrrolidin-3-amine |
| SMILES | CC1(C)CSCC(NC2CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C18H28N2S/c1-18(2)10-17(13-21-14-18)19-16-8-9-20(12-16)11-15-6-4-3-5-7-15/h3-7,16-17,19H,8-14H2,1-2H3 |
| InChIKey | LTHYGUKOKKECFF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |