About N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine
N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine (PubChem CID 79953807) has the molecular formula C17H24N2OS
and a molecular weight of 304.46 g/mol. Its IUPAC name is N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine |
| PubChem CID | 79953807 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine |
| SMILES | CC(C)c1nc2cc(NC3CSCC(C)(C)C3)ccc2o1 |
| InChI | InChI=1S/C17H24N2OS/c1-11(2)16-19-14-7-12(5-6-15(14)20-16)18-13-8-17(3,4)10-21-9-13/h5-7,11,13,18H,8-10H2,1-4H3 |
| InChIKey | QXGSFPJRMKPTRI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine?
The IUPAC name of N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine (CID 79953807) is N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine.
What is the SMILES notation for N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine?
The canonical SMILES for N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine is CC(C)c1nc2cc(NC3CSCC(C)(C)C3)ccc2o1.
What is the InChIKey of N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine?
The InChIKey is QXGSFPJRMKPTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2OS/c1-11(2)16-19-14-7-12(5-6-15(14)20-16)18-13-8-17(3,4)10-21-9-13/h5-7,11,13,18H,8-10H2,1-4H3.
What are the key properties of N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine?
N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine has a molecular weight of 304.46 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,5-dimethylthian-3-yl)-2-propan-2-yl-1,3-benzoxazol-5-amine is sourced from PubChem (CID 79953807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).