C12H19F3O — CID 79953893
1-(3,4-dimethylcyclohexyl)-4,4,4-trifluorobutan-1-one (PubChem CID 79953893) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 79953893 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-4,4,4-trifluorobutan-1-one |
| SMILES | CC1CCC(C(=O)CCC(F)(F)F)CC1C |
| InChI | InChI=1S/C12H19F3O/c1-8-3-4-10(7-9(8)2)11(16)5-6-12(13,14)15/h8-10H,3-7H2,1-2H3 |
| InChIKey | DVFHDRBXONPEDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |