About 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one
1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one (PubChem CID 79954068) has the molecular formula C14H19F3N2O
and a molecular weight of 288.31 g/mol. Its IUPAC name is 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one.
Molecular Properties
| Compound Name | 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one |
| PubChem CID | 79954068 |
| Molecular Formula | C14H19F3N2O |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C14H19F3N2O/c15-14(16,17)8-6-13(20)10-11-7-9-19(18-11)12-4-2-1-3-5-12/h7,9,12H,1-6,8,10H2 |
| InChIKey | CQMKFEVTQUQIML-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one?
The IUPAC name of 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one (CID 79954068) is 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one.
What is the SMILES notation for 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one?
The canonical SMILES for 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one is O=C(CCC(F)(F)F)Cc1ccn(C2CCCCC2)n1.
What is the InChIKey of 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one?
The InChIKey is CQMKFEVTQUQIML-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F3N2O/c15-14(16,17)8-6-13(20)10-11-7-9-19(18-11)12-4-2-1-3-5-12/h7,9,12H,1-6,8,10H2.
What are the key properties of 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one?
1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one has a molecular weight of 288.31 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclohexylpyrazol-3-yl)-5,5,5-trifluoropentan-2-one is sourced from PubChem (CID 79954068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).