C7H8ClF3N2O — CID 79954381
5-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole (PubChem CID 79954381) has the molecular formula C7H8ClF3N2O and a molecular weight of 228.60 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 79954381 |
| Molecular Formula | C7H8ClF3N2O |
| Molecular Weight | 228.60 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | 5-(1-chloroethyl)-3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazole |
| SMILES | CC(Cl)c1nc(CCC(F)(F)F)no1 |
| InChI | InChI=1S/C7H8ClF3N2O/c1-4(8)6-12-5(13-14-6)2-3-7(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | VVKPBRUUVYBOAL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.60 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|