About N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine
N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine (PubChem CID 79954460) has the molecular formula C14H26F3N
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine |
| PubChem CID | 79954460 |
| Molecular Formula | C14H26F3N |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine |
| SMILES | CCNC(CCC(F)(F)F)C1CCCCC1CC |
| InChI | InChI=1S/C14H26F3N/c1-3-11-7-5-6-8-12(11)13(18-4-2)9-10-14(15,16)17/h11-13,18H,3-10H2,1-2H3 |
| InChIKey | FZXURQRHILTDQU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
The IUPAC name of N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine (CID 79954460) is N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine.
What is the SMILES notation for N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
The canonical SMILES for N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine is CCNC(CCC(F)(F)F)C1CCCCC1CC.
What is the InChIKey of N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
The InChIKey is FZXURQRHILTDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26F3N/c1-3-11-7-5-6-8-12(11)13(18-4-2)9-10-14(15,16)17/h11-13,18H,3-10H2,1-2H3.
What are the key properties of N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine?
N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine has a molecular weight of 265.36 g/mol, XLogP of 4.52, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1-(2-ethylcyclohexyl)-4,4,4-trifluorobutan-1-amine is sourced from PubChem (CID 79954460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).