C7H7F3N6O — CID 79954733
5-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 79954733) has the molecular formula C7H7F3N6O and a molecular weight of 248.17 g/mol. Its IUPAC name is 5-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 79954733 |
| Molecular Formula | C7H7F3N6O |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | Nc1n[nH]c(-c2nc(CCC(F)(F)F)no2)n1 |
| InChI | InChI=1S/C7H7F3N6O/c8-7(9,10)2-1-3-12-5(17-16-3)4-13-6(11)15-14-4/h1-2H2,(H3,11,13,14,15) |
| InChIKey | DNOSQKLRAHNMNS-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |