C9H8BrF3OS — CID 79954901
1-(3-bromothiophen-2-yl)-5,5,5-trifluoropentan-2-one (PubChem CID 79954901) has the molecular formula C9H8BrF3OS and a molecular weight of 301.13 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)-5,5,5-trifluoropentan-2-one.
| Compound Name | 1-(3-bromothiophen-2-yl)-5,5,5-trifluoropentan-2-one |
|---|---|
| PubChem CID | 79954901 |
| Molecular Formula | C9H8BrF3OS |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 299.94 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)-5,5,5-trifluoropentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1sccc1Br |
| InChI | InChI=1S/C9H8BrF3OS/c10-7-2-4-15-8(7)5-6(14)1-3-9(11,12)13/h2,4H,1,3,5H2 |
| InChIKey | UCLKJTXSYOBOID-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |