C11H8F5N3O — CID 79955016
4,5-difluoro-2-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 79955016) has the molecular formula C11H8F5N3O and a molecular weight of 293.19 g/mol. Its IUPAC name is 4,5-difluoro-2-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 4,5-difluoro-2-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 79955016 |
| Molecular Formula | C11H8F5N3O |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4,5-difluoro-2-[3-(3,3,3-trifluoropropyl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cc(F)c(F)cc1-c1nc(CCC(F)(F)F)no1 |
| InChI | InChI=1S/C11H8F5N3O/c12-6-3-5(8(17)4-7(6)13)10-18-9(19-20-10)1-2-11(14,15)16/h3-4H,1-2,17H2 |
| InChIKey | VRVKFHMCKGPHNE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|