C9H12F3NO2S — CID 79955026
4-(dimethoxymethyl)-2-(3,3,3-trifluoropropyl)-1,3-thiazole (PubChem CID 79955026) has the molecular formula C9H12F3NO2S and a molecular weight of 255.26 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(3,3,3-trifluoropropyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(3,3,3-trifluoropropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 79955026 |
| Molecular Formula | C9H12F3NO2S |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(3,3,3-trifluoropropyl)-1,3-thiazole |
| SMILES | COC(OC)c1csc(CCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3NO2S/c1-14-8(15-2)6-5-16-7(13-6)3-4-9(10,11)12/h5,8H,3-4H2,1-2H3 |
| InChIKey | JMBUWZCSJUKOIO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|