About 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine
6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 79955430) has the molecular formula C9H11BrN4
and a molecular weight of 255.12 g/mol. Its IUPAC name is 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 79955430 |
| Molecular Formula | C9H11BrN4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCN(C)c1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C9H11BrN4/c1-3-13(2)9-8-11-4-5-14(8)6-7(10)12-9/h4-6H,3H2,1-2H3 |
| InChIKey | XXHGRBRKADZONL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine (CID 79955430) is 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine is CCN(C)c1nc(Br)cn2ccnc12.
What is the InChIKey of 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is XXHGRBRKADZONL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN4/c1-3-13(2)9-8-11-4-5-14(8)6-7(10)12-9/h4-6H,3H2,1-2H3.
What are the key properties of 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine?
6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 255.12 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-ethyl-N-methylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 79955430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).