About 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol
2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol (PubChem CID 79955614) has the molecular formula C15H23NOS
and a molecular weight of 265.42 g/mol. Its IUPAC name is 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol.
Molecular Properties
| Compound Name | 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol |
| PubChem CID | 79955614 |
| Molecular Formula | C15H23NOS |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol |
| SMILES | CC1(C)CSCC(NCC(O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H23NOS/c1-15(2)8-13(10-18-11-15)16-9-14(17)12-6-4-3-5-7-12/h3-7,13-14,16-17H,8-11H2,1-2H3 |
| InChIKey | VGJYCZYFFJKYNV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol?
The IUPAC name of 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol (CID 79955614) is 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol.
What is the SMILES notation for 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol?
The canonical SMILES for 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol is CC1(C)CSCC(NCC(O)c2ccccc2)C1.
What is the InChIKey of 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol?
The InChIKey is VGJYCZYFFJKYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOS/c1-15(2)8-13(10-18-11-15)16-9-14(17)12-6-4-3-5-7-12/h3-7,13-14,16-17H,8-11H2,1-2H3.
What are the key properties of 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol?
2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol has a molecular weight of 265.42 g/mol, XLogP of 2.84, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,5-dimethylthian-3-yl)amino]-1-phenylethanol is sourced from PubChem (CID 79955614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).