About 2-(4,4-dimethylthian-3-ylidene)acetonitrile
2-(4,4-dimethylthian-3-ylidene)acetonitrile (PubChem CID 79955824) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 2-(4,4-dimethylthian-3-ylidene)acetonitrile.
Molecular Properties
| Compound Name | 2-(4,4-dimethylthian-3-ylidene)acetonitrile |
| PubChem CID | 79955824 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-(4,4-dimethylthian-3-ylidene)acetonitrile |
| SMILES | CC1(C)CCSCC1=CC#N |
| InChI | InChI=1S/C9H13NS/c1-9(2)4-6-11-7-8(9)3-5-10/h3H,4,6-7H2,1-2H3 |
| InChIKey | DSIJNUADKXFFGW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,4-dimethylthian-3-ylidene)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylthian-3-ylidene)acetonitrile?
The IUPAC name of 2-(4,4-dimethylthian-3-ylidene)acetonitrile (CID 79955824) is 2-(4,4-dimethylthian-3-ylidene)acetonitrile.
What is the SMILES notation for 2-(4,4-dimethylthian-3-ylidene)acetonitrile?
The canonical SMILES for 2-(4,4-dimethylthian-3-ylidene)acetonitrile is CC1(C)CCSCC1=CC#N.
What is the InChIKey of 2-(4,4-dimethylthian-3-ylidene)acetonitrile?
The InChIKey is DSIJNUADKXFFGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-9(2)4-6-11-7-8(9)3-5-10/h3H,4,6-7H2,1-2H3.
What are the key properties of 2-(4,4-dimethylthian-3-ylidene)acetonitrile?
2-(4,4-dimethylthian-3-ylidene)acetonitrile has a molecular weight of 167.28 g/mol, XLogP of 2.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylthian-3-ylidene)acetonitrile is sourced from PubChem (CID 79955824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).