C14H26O2S — CID 79955990
4,4-dimethyl-3-[3-(oxolan-2-yl)propyl]thian-3-ol (PubChem CID 79955990) has the molecular formula C14H26O2S and a molecular weight of 258.43 g/mol. Its IUPAC name is 4,4-dimethyl-3-[3-(oxolan-2-yl)propyl]thian-3-ol.
| Compound Name | 4,4-dimethyl-3-[3-(oxolan-2-yl)propyl]thian-3-ol |
|---|---|
| PubChem CID | 79955990 |
| Molecular Formula | C14H26O2S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4,4-dimethyl-3-[3-(oxolan-2-yl)propyl]thian-3-ol |
| SMILES | CC1(C)CCSCC1(O)CCCC1CCCO1 |
| InChI | InChI=1S/C14H26O2S/c1-13(2)8-10-17-11-14(13,15)7-3-5-12-6-4-9-16-12/h12,15H,3-11H2,1-2H3 |
| InChIKey | WFNLNBCYKINQJI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |