About 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol
3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol (PubChem CID 79956066) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol.
Molecular Properties
| Compound Name | 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol |
| PubChem CID | 79956066 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol |
| SMILES | CC1(C)CCSCC1(O)c1cnccc1N |
| InChI | InChI=1S/C12H18N2OS/c1-11(2)4-6-16-8-12(11,15)9-7-14-5-3-10(9)13/h3,5,7,15H,4,6,8H2,1-2H3,(H2,13,14) |
| InChIKey | MBDUOVGRTWVRPS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol?
The IUPAC name of 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol (CID 79956066) is 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol.
What is the SMILES notation for 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol?
The canonical SMILES for 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol is CC1(C)CCSCC1(O)c1cnccc1N.
What is the InChIKey of 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol?
The InChIKey is MBDUOVGRTWVRPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2OS/c1-11(2)4-6-16-8-12(11,15)9-7-14-5-3-10(9)13/h3,5,7,15H,4,6,8H2,1-2H3,(H2,13,14).
What are the key properties of 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol?
3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol has a molecular weight of 238.36 g/mol, XLogP of 2.01, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-amino-3-pyridinyl)-4,4-dimethylthian-3-ol is sourced from PubChem (CID 79956066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).