About 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide
2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide (PubChem CID 79956326) has the molecular formula C10H12BrN5O
and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide |
| PubChem CID | 79956326 |
| Molecular Formula | C10H12BrN5O |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C10H12BrN5O/c1-15(2)8(17)5-13-9-10-12-3-4-16(10)6-7(11)14-9/h3-4,6H,5H2,1-2H3,(H,13,14) |
| InChIKey | BANLLQPNYAYHMW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide (CID 79956326) is 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide is CN(C)C(=O)CNc1nc(Br)cn2ccnc12.
What is the InChIKey of 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide?
The InChIKey is BANLLQPNYAYHMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN5O/c1-15(2)8(17)5-13-9-10-12-3-4-16(10)6-7(11)14-9/h3-4,6H,5H2,1-2H3,(H,13,14).
What are the key properties of 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide?
2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide has a molecular weight of 298.14 g/mol, XLogP of 0.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 79956326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).