About 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione
5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione (PubChem CID 79956395) has the molecular formula C15H18N2O2S
and a molecular weight of 290.39 g/mol. Its IUPAC name is 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione |
| PubChem CID | 79956395 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione |
| SMILES | CC1(C)CSCC(Nc2ccc3c(c2)C(=O)NC3=O)C1 |
| InChI | InChI=1S/C15H18N2O2S/c1-15(2)6-10(7-20-8-15)16-9-3-4-11-12(5-9)14(19)17-13(11)18/h3-5,10,16H,6-8H2,1-2H3,(H,17,18,19) |
| InChIKey | SSWZHZIEUJYDSL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione?
The IUPAC name of 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione (CID 79956395) is 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione.
What is the SMILES notation for 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione?
The canonical SMILES for 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione is CC1(C)CSCC(Nc2ccc3c(c2)C(=O)NC3=O)C1.
What is the InChIKey of 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione?
The InChIKey is SSWZHZIEUJYDSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-15(2)6-10(7-20-8-15)16-9-3-4-11-12(5-9)14(19)17-13(11)18/h3-5,10,16H,6-8H2,1-2H3,(H,17,18,19).
What are the key properties of 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione?
5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione has a molecular weight of 290.39 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5,5-dimethylthian-3-yl)amino]isoindole-1,3-dione is sourced from PubChem (CID 79956395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).