C13H28N2S — CID 79956979
3-(aminomethyl)-N,2-dimethyl-N-pentan-3-ylthian-3-amine (PubChem CID 79956979) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is 3-(aminomethyl)-N,2-dimethyl-N-pentan-3-ylthian-3-amine.
| Compound Name | 3-(aminomethyl)-N,2-dimethyl-N-pentan-3-ylthian-3-amine |
|---|---|
| PubChem CID | 79956979 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 3-(aminomethyl)-N,2-dimethyl-N-pentan-3-ylthian-3-amine |
| SMILES | CCC(CC)N(C)C1(CN)CCCSC1C |
| InChI | InChI=1S/C13H28N2S/c1-5-12(6-2)15(4)13(10-14)8-7-9-16-11(13)3/h11-12H,5-10,14H2,1-4H3 |
| InChIKey | KZRZGKBDLACHDS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |