About N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine
N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine (PubChem CID 79957831) has the molecular formula C14H20ClNO2S
and a molecular weight of 301.84 g/mol. Its IUPAC name is N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine.
Molecular Properties
| Compound Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine |
| PubChem CID | 79957831 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine |
| SMILES | COc1cc(Cl)c(NC2CCCSC2C)cc1OC |
| InChI | InChI=1S/C14H20ClNO2S/c1-9-11(5-4-6-19-9)16-12-8-14(18-3)13(17-2)7-10(12)15/h7-9,11,16H,4-6H2,1-3H3 |
| InChIKey | HAICZUYZJUOQMK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine?
The IUPAC name of N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine (CID 79957831) is N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine.
What is the SMILES notation for N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine?
The canonical SMILES for N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine is COc1cc(Cl)c(NC2CCCSC2C)cc1OC.
What is the InChIKey of N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine?
The InChIKey is HAICZUYZJUOQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO2S/c1-9-11(5-4-6-19-9)16-12-8-14(18-3)13(17-2)7-10(12)15/h7-9,11,16H,4-6H2,1-3H3.
What are the key properties of N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine?
N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine has a molecular weight of 301.84 g/mol, XLogP of 4.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloro-4,5-dimethoxyphenyl)-2-methylthian-3-amine is sourced from PubChem (CID 79957831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).