About 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol
4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol (PubChem CID 79958569) has the molecular formula C14H21NOS
and a molecular weight of 251.39 g/mol. Its IUPAC name is 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol.
Molecular Properties
| Compound Name | 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol |
| PubChem CID | 79958569 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1NC1CSCC(C)(C)C1 |
| InChI | InChI=1S/C14H21NOS/c1-10-6-12(16)4-5-13(10)15-11-7-14(2,3)9-17-8-11/h4-6,11,15-16H,7-9H2,1-3H3 |
| InChIKey | PLDZTKTUBPOTNV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol?
The IUPAC name of 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol (CID 79958569) is 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol.
What is the SMILES notation for 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol?
The canonical SMILES for 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol is Cc1cc(O)ccc1NC1CSCC(C)(C)C1.
What is the InChIKey of 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol?
The InChIKey is PLDZTKTUBPOTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NOS/c1-10-6-12(16)4-5-13(10)15-11-7-14(2,3)9-17-8-11/h4-6,11,15-16H,7-9H2,1-3H3.
What are the key properties of 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol?
4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol has a molecular weight of 251.39 g/mol, XLogP of 3.64, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5,5-dimethylthian-3-yl)amino]-3-methylphenol is sourced from PubChem (CID 79958569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).