About N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine
N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine (PubChem CID 79958697) has the molecular formula C16H25NO2S
and a molecular weight of 295.45 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine.
Molecular Properties
| Compound Name | N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine |
| PubChem CID | 79958697 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine |
| SMILES | COc1cc(C)c(NC2CSCC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C16H25NO2S/c1-11-6-14(18-4)15(19-5)7-13(11)17-12-8-16(2,3)10-20-9-12/h6-7,12,17H,8-10H2,1-5H3 |
| InChIKey | IPKWDEWVOYCOGF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine?
The IUPAC name of N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine (CID 79958697) is N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine.
What is the SMILES notation for N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine?
The canonical SMILES for N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine is COc1cc(C)c(NC2CSCC(C)(C)C2)cc1OC.
What is the InChIKey of N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine?
The InChIKey is IPKWDEWVOYCOGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2S/c1-11-6-14(18-4)15(19-5)7-13(11)17-12-8-16(2,3)10-20-9-12/h6-7,12,17H,8-10H2,1-5H3.
What are the key properties of N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine?
N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine has a molecular weight of 295.45 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dimethoxy-2-methylphenyl)-5,5-dimethylthian-3-amine is sourced from PubChem (CID 79958697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).