About 4-amino-5-heptyl-1,5-dimethylimidazol-2-one
4-amino-5-heptyl-1,5-dimethylimidazol-2-one (PubChem CID 79959265) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 4-amino-5-heptyl-1,5-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 4-amino-5-heptyl-1,5-dimethylimidazol-2-one |
| PubChem CID | 79959265 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 4-amino-5-heptyl-1,5-dimethylimidazol-2-one |
| SMILES | CCCCCCCC1(C)C(N)=NC(=O)N1C |
| InChI | InChI=1S/C12H23N3O/c1-4-5-6-7-8-9-12(2)10(13)14-11(16)15(12)3/h4-9H2,1-3H3,(H2,13,14,16) |
| InChIKey | OEZVHOOSYLWNOG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-heptyl-1,5-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-heptyl-1,5-dimethylimidazol-2-one?
The IUPAC name of 4-amino-5-heptyl-1,5-dimethylimidazol-2-one (CID 79959265) is 4-amino-5-heptyl-1,5-dimethylimidazol-2-one.
What is the SMILES notation for 4-amino-5-heptyl-1,5-dimethylimidazol-2-one?
The canonical SMILES for 4-amino-5-heptyl-1,5-dimethylimidazol-2-one is CCCCCCCC1(C)C(N)=NC(=O)N1C.
What is the InChIKey of 4-amino-5-heptyl-1,5-dimethylimidazol-2-one?
The InChIKey is OEZVHOOSYLWNOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-4-5-6-7-8-9-12(2)10(13)14-11(16)15(12)3/h4-9H2,1-3H3,(H2,13,14,16).
What are the key properties of 4-amino-5-heptyl-1,5-dimethylimidazol-2-one?
4-amino-5-heptyl-1,5-dimethylimidazol-2-one has a molecular weight of 225.34 g/mol, XLogP of 2.53, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-heptyl-1,5-dimethylimidazol-2-one is sourced from PubChem (CID 79959265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).