About N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine
N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine (PubChem CID 79959332) has the molecular formula C16H20N2OS2
and a molecular weight of 320.48 g/mol. Its IUPAC name is N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine.
Molecular Properties
| Compound Name | N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine |
| PubChem CID | 79959332 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine |
| SMILES | CNC(Cc1csc(C2CSCCO2)n1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2OS2/c1-17-14(12-5-3-2-4-6-12)9-13-10-21-16(18-13)15-11-20-8-7-19-15/h2-6,10,14-15,17H,7-9,11H2,1H3 |
| InChIKey | XQSAQOLYPCPANA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine?
The IUPAC name of N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine (CID 79959332) is N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine.
What is the SMILES notation for N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine?
The canonical SMILES for N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine is CNC(Cc1csc(C2CSCCO2)n1)c1ccccc1.
What is the InChIKey of N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine?
The InChIKey is XQSAQOLYPCPANA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2OS2/c1-17-14(12-5-3-2-4-6-12)9-13-10-21-16(18-13)15-11-20-8-7-19-15/h2-6,10,14-15,17H,7-9,11H2,1H3.
What are the key properties of N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine?
N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine has a molecular weight of 320.48 g/mol, XLogP of 3.45, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-[2-(1,4-oxathian-2-yl)-1,3-thiazol-4-yl]-1-phenylethanamine is sourced from PubChem (CID 79959332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).