About 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one
4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one (PubChem CID 79959445) has the molecular formula C13H20N4O
and a molecular weight of 248.33 g/mol. Its IUPAC name is 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one.
Molecular Properties
| Compound Name | 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one |
| PubChem CID | 79959445 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one |
| SMILES | CN1C2CCC1CC1(C2)C(N)=NC(=O)N1C1CC1 |
| InChI | InChI=1S/C13H20N4O/c1-16-9-4-5-10(16)7-13(6-9)11(14)15-12(18)17(13)8-2-3-8/h8-10H,2-7H2,1H3,(H2,14,15,18) |
| InChIKey | XORPLDIDGISNBO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one?
The IUPAC name of 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one (CID 79959445) is 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one.
What is the SMILES notation for 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one?
The canonical SMILES for 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one is CN1C2CCC1CC1(C2)C(N)=NC(=O)N1C1CC1.
What is the InChIKey of 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one?
The InChIKey is XORPLDIDGISNBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O/c1-16-9-4-5-10(16)7-13(6-9)11(14)15-12(18)17(13)8-2-3-8/h8-10H,2-7H2,1H3,(H2,14,15,18).
What are the key properties of 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one?
4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one has a molecular weight of 248.33 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-amino-1'-cyclopropyl-8-methylspiro[8-azabicyclo[3.2.1]octane-3,5'-imidazole]-2'-one is sourced from PubChem (CID 79959445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).