About 4-amino-5-methyl-1,5-dipropylimidazol-2-one
4-amino-5-methyl-1,5-dipropylimidazol-2-one (PubChem CID 79959459) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-amino-5-methyl-1,5-dipropylimidazol-2-one.
Molecular Properties
| Compound Name | 4-amino-5-methyl-1,5-dipropylimidazol-2-one |
| PubChem CID | 79959459 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 4-amino-5-methyl-1,5-dipropylimidazol-2-one |
| SMILES | CCCN1C(=O)N=C(N)C1(C)CCC |
| InChI | InChI=1S/C10H19N3O/c1-4-6-10(3)8(11)12-9(14)13(10)7-5-2/h4-7H2,1-3H3,(H2,11,12,14) |
| InChIKey | DUUAKGLQEJOTCP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-5-methyl-1,5-dipropylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-methyl-1,5-dipropylimidazol-2-one?
The IUPAC name of 4-amino-5-methyl-1,5-dipropylimidazol-2-one (CID 79959459) is 4-amino-5-methyl-1,5-dipropylimidazol-2-one.
What is the SMILES notation for 4-amino-5-methyl-1,5-dipropylimidazol-2-one?
The canonical SMILES for 4-amino-5-methyl-1,5-dipropylimidazol-2-one is CCCN1C(=O)N=C(N)C1(C)CCC.
What is the InChIKey of 4-amino-5-methyl-1,5-dipropylimidazol-2-one?
The InChIKey is DUUAKGLQEJOTCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O/c1-4-6-10(3)8(11)12-9(14)13(10)7-5-2/h4-7H2,1-3H3,(H2,11,12,14).
What are the key properties of 4-amino-5-methyl-1,5-dipropylimidazol-2-one?
4-amino-5-methyl-1,5-dipropylimidazol-2-one has a molecular weight of 197.28 g/mol, XLogP of 1.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-methyl-1,5-dipropylimidazol-2-one is sourced from PubChem (CID 79959459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).