About 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one
4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one (PubChem CID 79959523) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one.
Molecular Properties
| Compound Name | 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one |
| PubChem CID | 79959523 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one |
| SMILES | CN1C(=O)N=C(N)C12CCc1ccccc1C2 |
| InChI | InChI=1S/C13H15N3O/c1-16-12(17)15-11(14)13(16)7-6-9-4-2-3-5-10(9)8-13/h2-5H,6-8H2,1H3,(H2,14,15,17) |
| InChIKey | UQRKWSPTSIQEOR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
The IUPAC name of 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one (CID 79959523) is 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one.
What is the SMILES notation for 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
The canonical SMILES for 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one is CN1C(=O)N=C(N)C12CCc1ccccc1C2.
What is the InChIKey of 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
The InChIKey is UQRKWSPTSIQEOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-16-12(17)15-11(14)13(16)7-6-9-4-2-3-5-10(9)8-13/h2-5H,6-8H2,1H3,(H2,14,15,17).
What are the key properties of 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one?
4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one has a molecular weight of 229.28 g/mol, XLogP of 1.34, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-amino-1'-methylspiro[2,4-dihydro-1H-naphthalene-3,5'-imidazole]-2'-one is sourced from PubChem (CID 79959523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).