C15H22F3N3 — CID 79959524
N-[3-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]propyl]cyclopropanamine (PubChem CID 79959524) has the molecular formula C15H22F3N3 and a molecular weight of 301.36 g/mol. Its IUPAC name is N-[3-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]propyl]cyclopropanamine.
| Compound Name | N-[3-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]propyl]cyclopropanamine |
|---|---|
| PubChem CID | 79959524 |
| Molecular Formula | C15H22F3N3 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[3-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]propyl]cyclopropanamine |
| SMILES | Cc1nc(CCC(F)(F)F)nc(C)c1CCCNC1CC1 |
| InChI | InChI=1S/C15H22F3N3/c1-10-13(4-3-9-19-12-5-6-12)11(2)21-14(20-10)7-8-15(16,17)18/h12,19H,3-9H2,1-2H3 |
| InChIKey | HVFCSWGOTYHKSM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|