C14H22F3N3O — CID 79959527
2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 79959527) has the molecular formula C14H22F3N3O and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 79959527 |
| Molecular Formula | C14H22F3N3O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCCc1c(C)nc(CCC(F)(F)F)nc1C |
| InChI | InChI=1S/C14H22F3N3O/c1-10-12(5-7-18-8-9-21-3)11(2)20-13(19-10)4-6-14(15,16)17/h18H,4-9H2,1-3H3 |
| InChIKey | VRBXVFDXEBBXGH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|