C15H24F3N3 — CID 79959528
2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-propylpropan-1-amine (PubChem CID 79959528) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is 2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-propylpropan-1-amine.
| Compound Name | 2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79959528 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 2-[4,6-dimethyl-2-(3,3,3-trifluoropropyl)pyrimidin-5-yl]-N-propylpropan-1-amine |
| SMILES | CCCNCC(C)c1c(C)nc(CCC(F)(F)F)nc1C |
| InChI | InChI=1S/C15H24F3N3/c1-5-8-19-9-10(2)14-11(3)20-13(21-12(14)4)6-7-15(16,17)18/h10,19H,5-9H2,1-4H3 |
| InChIKey | NWCHVSAQICFXRB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|