About 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one
4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 79959716) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 79959716 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | CC1CC2(CCO1)C(N)=NC(=O)N2C |
| InChI | InChI=1S/C9H15N3O2/c1-6-5-9(3-4-14-6)7(10)11-8(13)12(9)2/h6H,3-5H2,1-2H3,(H2,10,11,13) |
| InChIKey | SKNQVAPXTVVRGM-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one (CID 79959716) is 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one is CC1CC2(CCO1)C(N)=NC(=O)N2C.
What is the InChIKey of 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
The InChIKey is SKNQVAPXTVVRGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6-5-9(3-4-14-6)7(10)11-8(13)12(9)2/h6H,3-5H2,1-2H3,(H2,10,11,13).
What are the key properties of 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one has a molecular weight of 197.24 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,7-dimethyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 79959716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).