About 2-propan-2-yloxyethanol
2-propan-2-yloxyethanol (PubChem CID 7996) has the molecular formula C5H12O2
and a molecular weight of 104.15 g/mol. Its IUPAC name is 2-propan-2-yloxyethanol.
Molecular Properties
| Compound Name | 2-propan-2-yloxyethanol |
| PubChem CID | 7996 |
| Molecular Formula | C5H12O2 |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.08 |
| IUPAC Name | 2-propan-2-yloxyethanol |
| SMILES | CC(C)OCCO |
| InChI | InChI=1S/C5H12O2/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3 |
| InChIKey | HCGFUIQPSOCUHI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-propan-2-yloxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxyethanol?
The IUPAC name of 2-propan-2-yloxyethanol (CID 7996) is 2-propan-2-yloxyethanol.
What is the SMILES notation for 2-propan-2-yloxyethanol?
The canonical SMILES for 2-propan-2-yloxyethanol is CC(C)OCCO.
What is the InChIKey of 2-propan-2-yloxyethanol?
The InChIKey is HCGFUIQPSOCUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2/c1-5(2)7-4-3-6/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-propan-2-yloxyethanol?
2-propan-2-yloxyethanol has a molecular weight of 104.15 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethanol is sourced from PubChem (CID 7996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).