About 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one
5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one (PubChem CID 79960070) has the molecular formula C12H13F2N3O
and a molecular weight of 253.25 g/mol. Its IUPAC name is 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one.
Molecular Properties
| Compound Name | 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one |
| PubChem CID | 79960070 |
| Molecular Formula | C12H13F2N3O |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one |
| SMILES | CCCN1C(=O)N=C(N)C1c1c(F)cccc1F |
| InChI | InChI=1S/C12H13F2N3O/c1-2-6-17-10(11(15)16-12(17)18)9-7(13)4-3-5-8(9)14/h3-5,10H,2,6H2,1H3,(H2,15,16,18) |
| InChIKey | GNGVCNKQRFXHPX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one?
The IUPAC name of 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one (CID 79960070) is 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one.
What is the SMILES notation for 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one?
The canonical SMILES for 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one is CCCN1C(=O)N=C(N)C1c1c(F)cccc1F.
What is the InChIKey of 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one?
The InChIKey is GNGVCNKQRFXHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F2N3O/c1-2-6-17-10(11(15)16-12(17)18)9-7(13)4-3-5-8(9)14/h3-5,10H,2,6H2,1H3,(H2,15,16,18).
What are the key properties of 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one?
5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one has a molecular weight of 253.25 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-(2,6-difluorophenyl)-3-propyl-4H-imidazol-2-one is sourced from PubChem (CID 79960070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).