C11H10F3N3O2 — CID 79960131
5-amino-3-methyl-4-[4-(trifluoromethoxy)phenyl]-4H-imidazol-2-one (PubChem CID 79960131) has the molecular formula C11H10F3N3O2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 5-amino-3-methyl-4-[4-(trifluoromethoxy)phenyl]-4H-imidazol-2-one.
| Compound Name | 5-amino-3-methyl-4-[4-(trifluoromethoxy)phenyl]-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79960131 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-amino-3-methyl-4-[4-(trifluoromethoxy)phenyl]-4H-imidazol-2-one |
| SMILES | CN1C(=O)N=C(N)C1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3N3O2/c1-17-8(9(15)16-10(17)18)6-2-4-7(5-3-6)19-11(12,13)14/h2-5,8H,1H3,(H2,15,16,18) |
| InChIKey | CULKQGPKPNTBJH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |