About 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one
4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one (PubChem CID 79960229) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 79960229 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one |
| SMILES | CN1CCC2(CC1)NC(=O)N=C2N |
| InChI | InChI=1S/C8H14N4O/c1-12-4-2-8(3-5-12)6(9)10-7(13)11-8/h2-5H2,1H3,(H3,9,10,11,13) |
| InChIKey | DIGVAGZETVIGBR-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one (CID 79960229) is 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one is CN1CCC2(CC1)NC(=O)N=C2N.
What is the InChIKey of 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one?
The InChIKey is DIGVAGZETVIGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4O/c1-12-4-2-8(3-5-12)6(9)10-7(13)11-8/h2-5H2,1H3,(H3,9,10,11,13).
What are the key properties of 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one?
4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one has a molecular weight of 182.23 g/mol, XLogP of -0.47, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-8-methyl-1,3,8-triazaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 79960229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).