C14H11N5OS — CID 79960380
2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)-1,3-benzoxazol-5-amine (PubChem CID 79960380) has the molecular formula C14H11N5OS and a molecular weight of 297.34 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79960380 |
| Molecular Formula | C14H11N5OS |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanylmethyl)-1,3-benzoxazol-5-amine |
| SMILES | Nc1ccc2oc(CSc3nnc4ccccn34)nc2c1 |
| InChI | InChI=1S/C14H11N5OS/c15-9-4-5-11-10(7-9)16-13(20-11)8-21-14-18-17-12-3-1-2-6-19(12)14/h1-7H,8,15H2 |
| InChIKey | OUGSRWDOBWUEEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|