C13H15N5O2S — CID 79960382
3-[(5-amino-1,3-benzoxazol-2-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 79960382) has the molecular formula C13H15N5O2S and a molecular weight of 305.36 g/mol. Its IUPAC name is 3-[(5-amino-1,3-benzoxazol-2-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(5-amino-1,3-benzoxazol-2-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 79960382 |
| Molecular Formula | C13H15N5O2S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[(5-amino-1,3-benzoxazol-2-yl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCc2nc3cc(N)ccc3o2)n[nH]c1=O |
| InChI | InChI=1S/C13H15N5O2S/c1-2-5-18-12(19)16-17-13(18)21-7-11-15-9-6-8(14)3-4-10(9)20-11/h3-4,6H,2,5,7,14H2,1H3,(H,16,19) |
| InChIKey | NXZCISQBLGJMEY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|