About 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one
4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 79960524) has the molecular formula C8H13N3O2
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 79960524 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | CN1C(=O)N=C(N)C12CCOCC2 |
| InChI | InChI=1S/C8H13N3O2/c1-11-7(12)10-6(9)8(11)2-4-13-5-3-8/h2-5H2,1H3,(H2,9,10,12) |
| InChIKey | JSERWSAMQLFKPG-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one (CID 79960524) is 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one is CN1C(=O)N=C(N)C12CCOCC2.
What is the InChIKey of 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
The InChIKey is JSERWSAMQLFKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2/c1-11-7(12)10-6(9)8(11)2-4-13-5-3-8/h2-5H2,1H3,(H2,9,10,12).
What are the key properties of 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one?
4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one has a molecular weight of 183.21 g/mol, XLogP of -0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-methyl-8-oxa-1,3-diazaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 79960524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).