About 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one
4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one (PubChem CID 79960902) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one |
| PubChem CID | 79960902 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one |
| SMILES | CN1C(=O)N=C(N)C12CCOC2 |
| InChI | InChI=1S/C7H11N3O2/c1-10-6(11)9-5(8)7(10)2-3-12-4-7/h2-4H2,1H3,(H2,8,9,11) |
| InChIKey | MDBQKIYPVHVVBD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one?
The IUPAC name of 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one (CID 79960902) is 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one.
What is the SMILES notation for 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one?
The canonical SMILES for 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one is CN1C(=O)N=C(N)C12CCOC2.
What is the InChIKey of 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one?
The InChIKey is MDBQKIYPVHVVBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-10-6(11)9-5(8)7(10)2-3-12-4-7/h2-4H2,1H3,(H2,8,9,11).
What are the key properties of 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one?
4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one has a molecular weight of 169.18 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-methyl-7-oxa-1,3-diazaspiro[4.4]non-3-en-2-one is sourced from PubChem (CID 79960902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).