C15H13N3O2 — CID 79960984
4-amino-5-(3-phenoxyphenyl)-1,5-dihydroimidazol-2-one (PubChem CID 79960984) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-amino-5-(3-phenoxyphenyl)-1,5-dihydroimidazol-2-one.
| Compound Name | 4-amino-5-(3-phenoxyphenyl)-1,5-dihydroimidazol-2-one |
|---|---|
| PubChem CID | 79960984 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 4-amino-5-(3-phenoxyphenyl)-1,5-dihydroimidazol-2-one |
| SMILES | NC1=NC(=O)NC1c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C15H13N3O2/c16-14-13(17-15(19)18-14)10-5-4-8-12(9-10)20-11-6-2-1-3-7-11/h1-9,13H,(H3,16,17,18,19) |
| InChIKey | MCQRGCSRGLABLT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |