About 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one
4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 79961183) has the molecular formula C7H11N3OS
and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one.
Molecular Properties
| Compound Name | 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one |
| PubChem CID | 79961183 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | NC1=NC(=O)NC12CCCSC2 |
| InChI | InChI=1S/C7H11N3OS/c8-5-7(10-6(11)9-5)2-1-3-12-4-7/h1-4H2,(H3,8,9,10,11) |
| InChIKey | KWETVXTVCMRJBC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one?
The IUPAC name of 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one (CID 79961183) is 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one.
What is the SMILES notation for 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one?
The canonical SMILES for 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one is NC1=NC(=O)NC12CCCSC2.
What is the InChIKey of 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one?
The InChIKey is KWETVXTVCMRJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3OS/c8-5-7(10-6(11)9-5)2-1-3-12-4-7/h1-4H2,(H3,8,9,10,11).
What are the key properties of 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one?
4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one has a molecular weight of 185.25 g/mol, XLogP of 0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-9-thia-1,3-diazaspiro[4.5]dec-3-en-2-one is sourced from PubChem (CID 79961183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).