About 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one
8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one (PubChem CID 79961367) has the molecular formula C5H8N4O
and a molecular weight of 140.15 g/mol. Its IUPAC name is 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one.
Molecular Properties
| Compound Name | 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one |
| PubChem CID | 79961367 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one |
| SMILES | NC1=NC(=O)NC12CNC2 |
| InChI | InChI=1S/C5H8N4O/c6-3-5(1-7-2-5)9-4(10)8-3/h7H,1-2H2,(H3,6,8,9,10) |
| InChIKey | NMFQMZLEYROOEH-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one?
The IUPAC name of 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one (CID 79961367) is 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one.
What is the SMILES notation for 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one?
The canonical SMILES for 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one is NC1=NC(=O)NC12CNC2.
What is the InChIKey of 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one?
The InChIKey is NMFQMZLEYROOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O/c6-3-5(1-7-2-5)9-4(10)8-3/h7H,1-2H2,(H3,6,8,9,10).
What are the key properties of 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one?
8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one has a molecular weight of 140.15 g/mol, XLogP of -1.59, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-2,5,7-triazaspiro[3.4]oct-7-en-6-one is sourced from PubChem (CID 79961367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).