About 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine
6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine (PubChem CID 79961478) has the molecular formula C15H24IN3S2
and a molecular weight of 437.42 g/mol. Its IUPAC name is 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine |
| PubChem CID | 79961478 |
| Molecular Formula | C15H24IN3S2 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C2CSCCS2)nc(C(C)(C)C)c1I |
| InChI | InChI=1S/C15H24IN3S2/c1-5-6-17-14-11(16)12(15(2,3)4)18-13(19-14)10-9-20-7-8-21-10/h10H,5-9H2,1-4H3,(H,17,18,19) |
| InChIKey | YIDGUTMNRCILLB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine?
The IUPAC name of 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine (CID 79961478) is 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine.
What is the SMILES notation for 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine?
The canonical SMILES for 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine is CCCNc1nc(C2CSCCS2)nc(C(C)(C)C)c1I.
What is the InChIKey of 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine?
The InChIKey is YIDGUTMNRCILLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24IN3S2/c1-5-6-17-14-11(16)12(15(2,3)4)18-13(19-14)10-9-20-7-8-21-10/h10H,5-9H2,1-4H3,(H,17,18,19).
What are the key properties of 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine?
6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine has a molecular weight of 437.42 g/mol, XLogP of 4.72, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-(1,4-dithian-2-yl)-5-iodo-N-propylpyrimidin-4-amine is sourced from PubChem (CID 79961478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).